CAS 1346447-15-1

6-Bromo-5-hydroxy-4-iodo-2-pyridinecarboxaldehyde

Description:

6-Bromo-5-hydroxy-4-iodo-2-pyridinecarboxaldehyde is a heterocyclic organic compound characterized by its pyridine ring, which is substituted with various functional groups. The presence of a bromine atom at the 6-position, a hydroxyl group at the 5-position, and an iodine atom at the 4-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The aldehyde functional group at the 2-position enhances its reactivity, making it a valuable intermediate in the synthesis of more complex molecules. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its solubility and stability can vary depending on the solvent and conditions, and it may require careful handling due to the presence of halogens, which can influence its toxicity and environmental impact. Overall, 6-Bromo-5-hydroxy-4-iodo-2-pyridinecarboxaldehyde represents a versatile building block in chemical research and development.

Formula: C₆H₃BrINO₂

InChI: InChI=1S/C6H3BrINO2/c7-6-5(11)4(8)1-3(2-10)9-6/h1-2,11H

InChI key: InChIKey=FOMPDHJYDDSBST-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(I)=C(O)C(Br)=N1

Synonyms:

• 6-Bromo-5-hydroxy-4-iodo-2-pyridinecarboxaldehyde
• 2-Pyridinecarboxaldehyde, 6-bromo-5-hydroxy-4-iodo-
• 6-Bromo-5-hydroxy-4-iodopicolinaldehyde