CAS 1346447-25-3
:5-Iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
Description:
5-Iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrrolopyridine core, an iodine substituent, and a phenylsulfonyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions and may form salts or esters. The iodine atom can enhance the compound's reactivity and influence its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the phenylsulfonyl moiety may contribute to the compound's ability to interact with biological targets, potentially leading to applications in drug development. Overall, this compound's unique structural features and functional groups position it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C14H9IN2O4S
InChI:InChI=1S/C14H9IN2O4S/c15-10-6-9-7-12(14(18)19)17(13(9)16-8-10)22(20,21)11-4-2-1-3-5-11/h1-8H,(H,18,19)
InChI key:InChIKey=ONPLACVRWZKSFI-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1C(O)=O)=CC(I)=CN2)C3=CC=CC=C3
Synonyms:- 5-Iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
- 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 5-iodo-1-(phenylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.