CymitQuimica logo

CAS 1346447-28-6

:

5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine-6-methanol

Description:
5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine-6-methanol is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine framework. This compound features a chlorine atom and an iodine atom substituting at specific positions on the pyrrolopyridine ring, contributing to its unique reactivity and potential biological activity. The presence of the hydroxymethyl group at the 6-position enhances its solubility in polar solvents and may influence its interaction with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen substituents that can modulate biological activity. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the functional groups present and the overall molecular geometry. As with many heterocycles, it may exhibit interesting electronic properties, making it a candidate for further research in organic synthesis and drug discovery.
Formula:C8H6ClIN2O
InChI:InChI=1S/C8H6ClIN2O/c9-5-1-4-6(10)2-11-8(4)12-7(5)3-13/h1-2,13H,3H2,(H,11,12)
InChI key:InChIKey=TUEZVWHQTVVJNT-UHFFFAOYSA-N
SMILES:IC=1C=2C(=NC(CO)=C(Cl)C2)NC1
Synonyms:
  • 5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine-6-methanol
  • 1H-Pyrrolo[2,3-b]pyridine-6-methanol, 5-chloro-3-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.