CAS 1346447-29-7
:3,4-Dihydro-6-iodo-2H-pyrano[3,2-b]pyridine-8-carboxylic acid
Description:
3,4-Dihydro-6-iodo-2H-pyrano[3,2-b]pyridine-8-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which includes a pyridine and a pyran ring. The presence of the iodine atom at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. This compound features a carboxylic acid functional group, which enhances its solubility in polar solvents and may influence its biological activity. The dihydro configuration indicates that the compound has two hydrogen atoms added to the pyridine ring, affecting its stability and reactivity. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's specific stereochemistry and functional groups may play a crucial role in its pharmacological properties. Overall, 3,4-Dihydro-6-iodo-2H-pyrano[3,2-b]pyridine-8-carboxylic acid represents a complex chemical entity with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C9H8INO3
InChI:InChI=1S/C9H8INO3/c10-7-4-5(9(12)13)8-6(11-7)2-1-3-14-8/h4H,1-3H2,(H,12,13)
InChI key:InChIKey=YILXTUKWZXNMFP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=NC(I)=C1)CCCO2
Synonyms:- 3,4-Dihydro-6-iodo-2H-pyrano[3,2-b]pyridine-8-carboxylic acid
- 2H-Pyrano[3,2-b]pyridine-8-carboxylic acid, 3,4-dihydro-6-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.