CAS 1346447-30-0
:N-(6-Chloro-5-iodo-2-pyridinyl)-2,2-dimethylpropanamide
Description:
N-(6-Chloro-5-iodo-2-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with chlorine and iodine atoms, contributing to its potential biological activity. The presence of the amide functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. The two-dimensional structure is further defined by the 2,2-dimethylpropanamide moiety, which adds steric bulk and may affect the compound's interaction with biological targets. This compound is likely to exhibit properties typical of halogenated pyridines, such as increased lipophilicity and potential for diverse pharmacological effects. Its specific applications and behavior in biological systems would depend on its interaction with various receptors or enzymes, making it of interest in medicinal chemistry and drug development. As with many halogenated compounds, considerations regarding its environmental impact and safety profile are essential for its use in research or therapeutic contexts.
Formula:C10H12ClIN2O
InChI:InChI=1S/C10H12ClIN2O/c1-10(2,3)9(15)14-7-5-4-6(12)8(11)13-7/h4-5H,1-3H3,(H,13,14,15)
InChI key:InChIKey=IOESIFMWDWDCBU-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1N=C(Cl)C(I)=CC1
Synonyms:- Propanamide, N-(6-chloro-5-iodo-2-pyridinyl)-2,2-dimethyl-
- N-(6-Chloro-5-iodo-2-pyridinyl)-2,2-dimethylpropanamide
- N-(6-Chloro-5-iodopyridin-2-yl)pivalamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.