CAS 1346447-41-3
:3-Amino-5-(3-hydroxypropyl)-2-pyridinecarbonitrile
Description:
3-Amino-5-(3-hydroxypropyl)-2-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a cyano group (-C≡N) attached to the pyridine ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of a hydroxypropyl side chain enhances its solubility and may influence its biological activity. The molecular structure suggests that it could participate in hydrogen bonding due to the hydroxyl group, which may affect its interactions with biological targets. Additionally, the cyano group can serve as a versatile functional group for further chemical modifications. This compound may be of interest in the development of pharmaceuticals or agrochemicals, given the importance of pyridine derivatives in these fields. Its specific properties, such as melting point, boiling point, and solubility, would require experimental determination or reference to literature for precise values.
Formula:C9H11N3O
InChI:InChI=1S/C9H11N3O/c10-5-9-8(11)4-7(6-12-9)2-1-3-13/h4,6,13H,1-3,11H2
InChI key:InChIKey=GBJVBFRDBSDKGY-UHFFFAOYSA-N
SMILES:C(CCO)C=1C=C(N)C(C#N)=NC1
Synonyms:- 3-Amino-5-(3-hydroxypropyl)-2-pyridinecarbonitrile
- 2-Pyridinecarbonitrile, 3-amino-5-(3-hydroxypropyl)-
- 3-Amino-5-(3-hydroxypropyl)picolinonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.