CAS 1346451-50-0

Methyl 3-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-6-yl)-2-propenoate

Description:

Methyl 3-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-6-yl)-2-propenoate is an organic compound characterized by its complex structure, which includes a methyl ester functional group and a pyrano-pyridine moiety. This compound typically exhibits properties associated with both esters and nitrogen-containing heterocycles, such as moderate polarity and potential for hydrogen bonding due to the presence of nitrogen. The pyrano-pyridine structure may contribute to its biological activity, making it of interest in medicinal chemistry. The compound is likely to be soluble in organic solvents, while its solubility in water may be limited due to its hydrophobic characteristics. Additionally, it may undergo typical organic reactions such as esterification, hydrolysis, and nucleophilic substitutions. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₂H₁₃NO₃

InChI: InChI=1S/C12H13NO3/c1-15-11(14)5-4-9-7-10-3-2-6-16-12(10)13-8-9/h4-5,7-8H,2-3,6H2,1H3

InChI key: InChIKey=HPKGMTGRIYMHNJ-UHFFFAOYSA-N

SMILES: C(=CC(OC)=O)C=1C=C2C(=NC1)OCCC2

Synonyms:

• Methyl 3-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-6-yl)-2-propenoate
• 2-Propenoic acid, 3-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-6-yl)-, methyl ester