CAS 1346521-33-2
:3,4,5-Trifluoro-N-methyl-2-nitrobenzenamine
Description:
3,4,5-Trifluoro-N-methyl-2-nitrobenzenamine is an organic compound characterized by the presence of a nitro group and a trifluoromethyl group on a benzene ring, along with a methylamine substituent. The trifluoro group contributes to its unique reactivity and polarity, making it a potentially useful intermediate in organic synthesis and pharmaceuticals. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic aromatic substitution reactions. This compound is likely to exhibit moderate to high solubility in polar solvents due to the presence of the nitro and amino functional groups. Additionally, the trifluoromethyl group can enhance the compound's stability and lipophilicity, which may affect its biological activity and interaction with other molecules. Safety data and handling precautions should be considered, as compounds containing nitro and amino groups can pose health risks. Overall, 3,4,5-Trifluoro-N-methyl-2-nitrobenzenamine is a complex molecule with significant potential in various chemical applications.
Formula:C7H5F3N2O2
InChI:InChI=1S/C7H5F3N2O2/c1-11-4-2-3(8)5(9)6(10)7(4)12(13)14/h2,11H,1H3
InChI key:InChIKey=WZQPNRSDHWCMEL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(NC)C=C(F)C(F)=C1F
Synonyms:- 3,4,5-Trifluoro-N-methyl-2-nitroaniline
- 3,4,5-Trifluoro-N-methyl-2-nitrobenzenamine
- Benzenamine, 3,4,5-trifluoro-N-methyl-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Methyl-2-nitro-3,4,5-trifluoroaniline
CAS:<p>N-Methyl-2-nitro-3,4,5-trifluoroaniline</p>Color and Shape:SolidMolecular weight:206.12g/mol
