CAS 134653-71-7: 1,1-Dimethylethyl (2Z)-2-[(dimethylamino)methylene]-3-oxobutanoate

Description:1,1-Dimethylethyl (2Z)-2-[(dimethylamino)methylene]-3-oxobutanoate, identified by its CAS number 134653-71-7, is an organic compound characterized by its complex structure, which includes a dimethylamino group and a butanoate moiety. This substance typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. The presence of the dimethylamino group suggests potential basicity and reactivity, making it of interest in various chemical reactions, particularly in organic synthesis. Additionally, the compound may exhibit biological activity, which could be relevant in pharmaceutical applications. Safety data should be consulted for handling and exposure guidelines, as compounds with similar structures can vary in toxicity and environmental impact. Overall, this compound's unique functional groups and structural features contribute to its potential utility in chemical research and industry.

Formula:C₁₁H₁₉NO₃

InChI:InChI=1S/C11H19NO3/c1-8(13)9(7-12(5)6)10(14)15-11(2,3)4/h7H,1-6H3/b9-7-

InChI key:InChIKey=KJFFPNCTSYAOCU-CLFYSBASSA-N

SMILES:O=C(OC(C)(C)C)C(=CN(C)C)C(=O)C

Synonyms:
Butanoic acid, 2-[(dimethylamino)methylene]-3-oxo-, 1,1-dimethylethyl ester, (Z)-
Butanoic acid, 2-[(dimethylamino)methylene]-3-oxo-, 1,1-dimethylethyl ester, (2Z)-
1,1-Dimethylethyl (2Z)-2-[(dimethylamino)methylene]-3-oxobutanoate