
CAS 1346541-61-4
:5-Bromo-2-methyl-3-pyridinecarboxamide
Description:
5-Bromo-2-methyl-3-pyridinecarboxamide is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 2-position of the pyridine ring contributes to its unique chemical properties. The carboxamide functional group, located at the 3-position, enhances its polarity and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of halogen and amide functionalities may influence its reactivity and stability under various conditions. As with many pyridine derivatives, it may also participate in hydrogen bonding, affecting its physical properties such as melting point and boiling point. Overall, 5-Bromo-2-methyl-3-pyridinecarboxamide is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H7BrN2O
InChI:InChI=1S/C7H7BrN2O/c1-4-6(7(9)11)2-5(8)3-10-4/h2-3H,1H3,(H2,9,11)
InChI key:InChIKey=SGZMKLMFJKEYOD-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(C)N=CC(Br)=C1
Synonyms:- 5-Bromo-2-methyl-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 5-bromo-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
