
CAS 1346597-51-0
:Ethyl 2,2-difluoro-3-(methylamino)propanoate
Description:
Ethyl 2,2-difluoro-3-(methylamino)propanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethyl alcohol) and a carboxylic acid. This compound features a propanoate backbone with two fluorine atoms attached to the second carbon, contributing to its unique chemical properties, such as increased lipophilicity and potential biological activity. The presence of a methylamino group at the third carbon enhances its potential for interaction with biological systems, making it of interest in medicinal chemistry. The fluorine substituents can influence the compound's reactivity and stability, often leading to altered pharmacokinetic properties. Ethyl 2,2-difluoro-3-(methylamino)propanoate may exhibit specific solubility characteristics, depending on the polarity introduced by the functional groups. Its CAS number, 1346597-51-0, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, this compound represents a class of fluorinated organic molecules with potential utility in diverse chemical applications.
Formula:C6H11F2NO2
InChI:InChI=1S/C6H11F2NO2/c1-3-11-5(10)6(7,8)4-9-2/h9H,3-4H2,1-2H3
InChI key:InChIKey=QQGZAZXFFVPRKU-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(CNC)(F)F
Synonyms:- Ethyl 2,2-difluoro-3-(methylamino)propanoate
- Propanoic acid, 2,2-difluoro-3-(methylamino)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.