CAS 1346597-55-4

1H-Indazole-4-carboxylic acid, 1-acetyl-6-bromo-, methyl ester

Description:

1H-Indazole-4-carboxylic acid, 1-acetyl-6-bromo-, methyl ester is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a carboxylic acid functional group, an acetyl group, and a bromine atom at specific positions on the indazole ring, contributing to its reactivity and potential biological activity. The presence of the methyl ester group indicates that the carboxylic acid is esterified, which can enhance lipophilicity and influence solubility in organic solvents. The bromine substituent may also impart unique electronic properties, making it a candidate for various synthetic applications or biological studies. Overall, this compound's structure suggests potential utility in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to the diverse reactivity patterns associated with indazole derivatives. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods.

Formula: C₁₁H₉BrN₂O₃

InChI: InChI=1S/C11H9BrN2O3/c1-6(15)14-10-4-7(12)3-8(11(16)17-2)9(10)5-13-14/h3-5H,1-2H3

InChI key: InChIKey=OPFAXWVSQSRJFT-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(N(C(C)=O)N=C2)=CC(Br)=C1

Synonyms:

• 1H-Indazole-4-carboxylic acid, 1-acetyl-6-bromo-, methyl ester
• Methyl 1-acetyl-6-bromo-1H-indazole-4-carboxylate

Methyl 1-acetyl-6-bromo-1H-indazole-4-carboxylate

CAS: 1346597-55-4

Formula: C₁₁H₉BrN₂O₃

Purity: 95%

Molecular weight: 297.1048

Ref: IN-DA003RJT