CAS 1346597-59-8

1,1-Dimethylethyl 4-[3-chloro-4-(methoxycarbonyl)phenyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[3-chloro-4-(methoxycarbonyl)phenyl]-1-piperazinecarboxylate, identified by its CAS number 1346597-59-8, is a chemical compound that features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a dimethyl group, a chloro substituent, and a methoxycarbonyl group, contributing to its overall reactivity and potential biological activity. The presence of the chloro group suggests that it may participate in nucleophilic substitution reactions, while the methoxycarbonyl group can influence its solubility and polarity. The compound's structure indicates it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperazine moiety, which is often found in various therapeutic agents. Additionally, the presence of multiple functional groups allows for potential interactions with biological targets, making it a candidate for further investigation in drug discovery and development.

Formula: C₁₇H₂₃ClN₂O₄

InChI: InChI=1S/C17H23ClN2O4/c1-17(2,3)24-16(22)20-9-7-19(8-10-20)12-5-6-13(14(18)11-12)15(21)23-4/h5-6,11H,7-10H2,1-4H3

InChI key: InChIKey=SRWURPOERWMOOY-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1C(OC)=O)N2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1,1-Dimethylethyl 4-[3-chloro-4-(methoxycarbonyl)phenyl]-1-piperazinecarboxylate
• 1-Piperazinecarboxylic acid, 4-[3-chloro-4-(methoxycarbonyl)phenyl]-, 1,1-dimethylethyl ester

Methyl 4-(4-Boc-1-piperazinyl)-2-chlorobenzoate

CAS: 1346597-59-8

Formula: C₁₇H₂₃ClN₂O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 354.8285

Ref: IN-DA003RTL