CAS 1346598-59-1
:DepropylaMino Hydroxy Propafenone-d5
Description:
DepropylaMino Hydroxy Propafenone-d5 is a deuterated derivative of propafenone, a class 1c antiarrhythmic agent used primarily for the treatment of certain types of cardiac arrhythmias. The deuterated form, indicated by the "d5" in its name, suggests that five hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen. This modification can enhance the compound's stability and alter its pharmacokinetic properties, making it useful in research applications, particularly in studies involving drug metabolism and pharmacodynamics. The compound retains the core structure of propafenone, which includes a phenylpropylamine moiety, contributing to its biological activity. Its characteristics include a specific molecular weight, solubility in organic solvents, and potential interactions with biological targets, which are essential for its function as an antiarrhythmic agent. Additionally, the presence of deuterium can aid in analytical techniques such as mass spectrometry, allowing for precise tracking of the compound in biological systems.
Formula:C18H20O4
InChI:InChI=1S/C18H20O4/c19-12-15(20)13-22-18-9-5-4-8-16(18)17(21)11-10-14-6-2-1-3-7-14/h1-9,15,19-20H,10-13H2/i12D2,13D2,15D
InChI key:InChIKey=KRSTZDUMPGTWJG-YZYYPZMPSA-N
SMILES:C(CCC1=CC=CC=C1)(=O)C2=C(OC(C(C(O)([2H])[2H])(O)[2H])([2H])[2H])C=CC=C2
Synonyms:- DepropylaMino Hydroxy Propafenone-d5
- 1-[2-[2,3-Dihydroxy(propoxy-d5)]phenyl]-3-phenyl-1-propanone
- 1-[2-(1,1,2,3,3-Pentadeuterio-2,3-dihydroxypropoxy)phenyl]-3-phenylpropan-1-one
- Propafenone Impurity 37
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Depropylamino Hydroxy Propafenone-d5
CAS:Controlled ProductApplications A labelled metabolite of the sodium channel blocker Propafenone (P757500).
References Hege, H.G. et al.: Arzneim.-Forsch., 34, 972 (1984); Hollmann, M., et al.: Arzneim.-Forsch., 33, 763 (1983); Bryson, H. M., et al.:Drugs, 45, 85 (1993);Formula:C18H15D5O4Color and Shape:NeatMolecular weight:305.38
