CymitQuimica logo

CAS 1346600-44-9

:

Formamide, N,N′-methylenebis[N-[9-[[2-(acetyloxy)ethoxy]methyl]-6-chloro-9H-purin-2-yl]-

Description:
Formamide, N,N′-methylenebis[N-[9-[[2-(acetyloxy)ethoxy]methyl]-6-chloro-9H-purin-2-yl]- is a complex organic compound characterized by its structure, which includes a formamide group and a methylene bridge connecting two purine derivatives. The presence of the chloro substituent and the acetyloxy-ethoxy moiety suggests that it may exhibit specific reactivity and solubility properties, potentially making it useful in biochemical applications or as a pharmaceutical intermediate. The compound is likely to be polar due to the presence of multiple functional groups, which may influence its solubility in various solvents. Additionally, the purine base structure indicates potential interactions with biological systems, possibly affecting nucleic acid metabolism or function. As with many organic compounds, safety data should be consulted to understand its toxicity, handling, and storage requirements. Overall, this compound's unique structure may confer interesting properties for research and application in medicinal chemistry or related fields.
Formula:C23H24Cl2N10O8
InChI:InChI=1S/C23H24Cl2N10O8/c1-14(38)42-5-3-40-12-32-7-26-16-18(24)28-22(30-20(16)32)34(10-36)9-35(11-37)23-29-19(25)17-21(31-23)33(8-27-17)13-41-4-6-43-15(2)39/h7-8,10-11H,3-6,9,12-13H2,1-2H3
InChI key:InChIKey=YOEGVXSXQJJZMC-UHFFFAOYSA-N
SMILES:C(OCCOC(C)=O)N1C=2C(=C(Cl)N=C(N(CN(C=O)C=3N=C4C(=C(Cl)N3)N=CN4COCCOC(C)=O)C=O)N2)N=C1
Synonyms:
  • 2-[[2-[[[9-(2-Acetyloxyethoxymethyl)-6-chloropurin-2-yl]-formylamino]methyl-formylamino]-6-chloropurin-9-yl]methoxy]ethyl acetate
  • Formamide, N,N′-methylenebis[N-[9-[[2-(acetyloxy)ethoxy]methyl]-6-chloro-9H-purin-2-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.