CAS 1346600-55-2

5-Bromothieno[2,3-b]pyridine-6-methanol

Description:

5-Bromothieno[2,3-b]pyridine-6-methanol is a heterocyclic organic compound characterized by the presence of a thieno[2,3-b]pyridine ring system, which incorporates both sulfur and nitrogen atoms in its structure. The compound features a bromine substituent at the 5-position of the thieno ring and a hydroxymethyl group (-CH2OH) at the 6-position, contributing to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxymethyl group. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The presence of the bromine atom may enhance its reactivity, making it a useful intermediate in organic synthesis. Additionally, the thieno[2,3-b]pyridine framework is known for its diverse pharmacological properties, which may include antimicrobial or anticancer activities. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₈H₆BrNOS

InChI: InChI=1S/C8H6BrNOS/c9-6-3-5-1-2-12-8(5)10-7(6)4-11/h1-3,11H,4H2

InChI key: InChIKey=QEEYGQMTUQYKDX-UHFFFAOYSA-N

SMILES: C(O)C=1N=C2C(=CC1Br)C=CS2

Synonyms:

• Thieno[2,3-b]pyridine-6-methanol, 5-bromo-
• 5-Bromothieno[2,3-b]pyridine-6-methanol