CAS 1346602-68-3

Azetidine, 2-(2-bromophenyl)-, hydrochloride (1:1)

Description:

Azetidine, 2-(2-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 2-bromophenyl group indicates that a bromine atom is substituted on the phenyl ring at the second position, contributing to the compound's unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or analgesic effects, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, Azetidine, 2-(2-bromophenyl)-, hydrochloride is a compound of interest for research and development in chemical and pharmaceutical fields.

Formula: C₉H₁₀BrN.ClH

InChI: InChI=1S/C9H10BrN.ClH/c10-8-4-2-1-3-7(8)9-5-6-11-9;/h1-4,9,11H,5-6H2;1H

InChI key: InChIKey=XMKPXCDFWAXOCF-UHFFFAOYSA-N

SMILES: BrC1=C(C=CC=C1)C2CCN2.Cl