CAS 1346604-91-8

1H-Azepine, hexahydro-2-(2-methylpropyl)-, hydrochloride (1:1)

Description:

1H-Azepine, hexahydro-2-(2-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclic structure, specifically a saturated seven-membered ring known as azepine. This compound features a hexahydro configuration, indicating that it is fully saturated with hydrogen atoms. The presence of a 2-(2-methylpropyl) substituent suggests that there is a branched alkyl group attached to the azepine ring, which can influence its physical and chemical properties, such as solubility and reactivity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which typically enhances its stability and solubility in water. As a hydrochloride, it may exhibit different pharmacological properties compared to its free base form. The compound's specific applications and biological activity would depend on its structural characteristics and interactions with biological systems, making it of interest in medicinal chemistry and related fields. However, detailed information regarding its toxicity, safety, and specific uses may require further investigation.

Formula: C₁₀H₂₁N·ClH

InChI: InChI=1S/C10H21N.ClH/c1-9(2)8-10-6-4-3-5-7-11-10;/h9-11H,3-8H2,1-2H3;1H

InChI key: InChIKey=FODROEQYRFKKLT-UHFFFAOYSA-N

SMILES: C(C(C)C)C1CCCCCN1.Cl

Synonyms:

• 1H-Azepine, hexahydro-2-(2-methylpropyl)-, hydrochloride (1:1)

Hexahydro-2-isobutyl-1H-azepine Hydrochloride

Controlled Product

CAS: 1346604-91-8

Formula: C₁₀H₂₁N·HCl

Color and Shape: Neat

Molecular weight: 191.741

Ref: TR-H294060