CAS 1346641-22-2

1-Cyclopentylcyclopropanecarboxylic acid

Description:

1-Cyclopentylcyclopropanecarboxylic acid is an organic compound characterized by its unique structure, which features a cyclopentyl group attached to a cyclopropane ring, with a carboxylic acid functional group. This compound typically exhibits properties associated with carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the cyclopentyl and cyclopropane moieties contributes to its three-dimensional shape, potentially affecting its reactivity and interactions with biological systems. It may also exhibit moderate volatility and stability under standard conditions. The compound's specific applications and behavior in chemical reactions can vary, but it may be of interest in fields such as medicinal chemistry or materials science due to its structural features. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₉H₁₄O₂

InChI: InChI=1S/C9H14O2/c10-8(11)9(5-6-9)7-3-1-2-4-7/h7H,1-6H2,(H,10,11)

InChI key: InChIKey=SXTCWDQCRZCJEH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C2CCCC2

Synonyms:

• 1-Cyclopentylcyclopropanecarboxylic acid
• Cyclopropanecarboxylic acid, 1-cyclopentyl-
• 1-Cyclopentylcyclopropane-1-carboxylic acid