CAS 1346672-64-7

5,6-Dihydro-5,5-dimethyl-4H-cyclopenta[b]thiophene-2-carboxylic acid

Description:

5,6-Dihydro-5,5-dimethyl-4H-cyclopenta[b]thiophene-2-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a thiophene ring fused to a cyclopentane moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential reactivity in various chemical reactions. The presence of two methyl groups at the 5-position enhances its steric bulk, which can influence its solubility and reactivity. The compound's structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the presence of both aromatic and aliphatic characteristics. Additionally, the thiophene ring is known for its electronic properties, which may impart interesting characteristics in electronic applications. Overall, 5,6-Dihydro-5,5-dimethyl-4H-cyclopenta[b]thiophene-2-carboxylic acid is a versatile compound with potential utility in various fields of chemistry.

Formula: C₁₀H₁₂O₂S

InChI: InChI=1S/C10H12O2S/c1-10(2)4-6-3-7(9(11)12)13-8(6)5-10/h3H,4-5H2,1-2H3,(H,11,12)

InChI key: InChIKey=RXULLQCHITUUFS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC2=C(S1)CC(C)(C)C2

Synonyms:

• 4H-Cyclopenta[b]thiophene-2-carboxylic acid, 5,6-dihydro-5,5-dimethyl-
• 5,6-Dihydro-5,5-dimethyl-4H-cyclopenta[b]thiophene-2-carboxylic acid

5,5-Dimethyl-4H,5H,6H-cyclopenta[b]thiophene-2-carboxylic acid

CAS: 1346672-64-7

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₂S

Purity: Min. 95%

Molecular weight: 196.27 g/mol

Ref: 3D-WDC67264