
CAS 1346674-24-5
:2-[2-[(Acetyloxy)methyl]-3-bromophenyl]-3,4,7,8-tetrahydro-7,7-dimethyl-2H-cyclopenta[4,5]pyrrolo[1,2-a]pyrazin-1(6H)-one
Description:
The chemical substance known as 2-[2-[(Acetyloxy)methyl]-3-bromophenyl]-3,4,7,8-tetrahydro-7,7-dimethyl-2H-cyclopenta[4,5]pyrrolo[1,2-a]pyrazin-1(6H)-one, with the CAS number 1346674-24-5, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including an acetyloxy group and a bromophenyl moiety, which contribute to its reactivity and potential biological activity. The presence of a tetrahydro-cyclopenta structure indicates a fused ring system, which may influence its conformational properties and interactions with biological targets. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas requiring compounds with specific binding affinities or therapeutic effects. However, detailed studies on its physical properties, solubility, stability, and biological activity would be necessary to fully understand its potential uses and implications in various fields, including pharmaceuticals and materials science.
Formula:C21H23BrN2O3
InChI:InChI=1S/C21H23BrN2O3/c1-13(25)27-12-15-16(22)5-4-6-17(15)24-8-7-23-18(20(24)26)9-14-10-21(2,3)11-19(14)23/h4-6,9H,7-8,10-12H2,1-3H3
InChI key:InChIKey=UEEANEVPYAKXRH-UHFFFAOYSA-N
SMILES:O=C1C=2N(C3=C(C2)CC(C)(C)C3)CCN1C4=C(COC(C)=O)C(Br)=CC=C4
Synonyms:- 2-Bromo-6-(7,7-dimethyl-1-oxo-3,4,7,8-tetrahydro-1H-cyclopenta[4,5]pyrrolo[1,2-a]pyrazin-2(6H)-yl)benzyl acetate
- 2H-Cyclopenta[4,5]pyrrolo[1,2-a]pyrazin-1(6H)-one, 2-[2-[(acetyloxy)methyl]-3-bromophenyl]-3,4,7,8-tetrahydro-7,7-dimethyl-
- 2-[2-[(Acetyloxy)methyl]-3-bromophenyl]-3,4,7,8-tetrahydro-7,7-dimethyl-2H-cyclopenta[4,5]pyrrolo[1,2-a]pyrazin-1(6H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.