
CAS 1346686-53-0
:[2,3′-Bipyridine]-5′-carboxaldehyde
Description:
[2,3′-Bipyridine]-5′-carboxaldehyde is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a carboxaldehyde functional group at the 5′ position introduces reactivity typical of aldehydes, such as the ability to undergo nucleophilic addition reactions. This compound is likely to exhibit properties associated with both aromatic and heterocyclic compounds, including stability and potential for coordination with metal ions, making it of interest in coordination chemistry and materials science. Its solubility is typically influenced by the polarity of the functional groups present, and it may be soluble in polar organic solvents. Additionally, [2,3′-Bipyridine]-5′-carboxaldehyde can serve as a building block in organic synthesis, particularly in the development of ligands for catalysis or in the synthesis of more complex organic molecules. Its unique structure and functional groups may also impart specific optical or electronic properties, which can be explored in various applications, including organic electronics and sensors.
Formula:C11H8N2O
InChI:InChI=1S/C11H8N2O/c14-8-9-5-10(7-12-6-9)11-3-1-2-4-13-11/h1-8H
InChI key:InChIKey=HFBJGHKHIBMRBA-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C2=CC=CC=N2
Synonyms:- [2,3′-Bipyridine]-5′-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
