CymitQuimica logo

CAS 1346686-58-5

:

3-Methyl[2,3′-bipyridine]-5′-carboxylic acid

Description:
3-Methyl[2,3′-bipyridine]-5′-carboxylic acid is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 3-position and a carboxylic acid functional group at the 5′-position contributes to its chemical reactivity and potential applications. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The bipyridine moiety may also impart coordination chemistry characteristics, making it useful in metal complexation. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or as a ligand in coordination chemistry due to its structural features. Its molecular structure suggests potential for diverse interactions in biological systems or materials science. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c1-8-3-2-4-14-11(8)9-5-10(12(15)16)7-13-6-9/h2-7H,1H3,(H,15,16)
InChI key:InChIKey=BRPCQEFLTBXAAZ-UHFFFAOYSA-N
SMILES:CC1=C(C=2C=C(C(O)=O)C=NC2)N=CC=C1
Synonyms:
  • [2,3′-Bipyridine]-5′-carboxylic acid, 3-methyl-
  • 3-Methyl[2,3′-bipyridine]-5′-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.