
CAS 1346686-59-6
:Methyl 3-methyl[2,3′-bipyridine]-5′-carboxylate
Description:
Methyl 3-methyl[2,3′-bipyridine]-5′-carboxylate, identified by its CAS number 1346686-59-6, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon bridge. This compound features a methyl group at the 3-position and a carboxylate ester functional group at the 5′-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group enhances its lipophilicity, which may influence its solubility in organic solvents. The carboxylate moiety can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Methyl 3-methyl[2,3′-bipyridine]-5′-carboxylate may be of interest in medicinal chemistry and materials science due to its structural properties, which can facilitate interactions with biological targets or incorporation into polymeric materials. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as temperature and pH.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c1-9-4-3-5-15-12(9)10-6-11(8-14-7-10)13(16)17-2/h3-8H,1-2H3
InChI key:InChIKey=PZFOJJDRTRTHHD-UHFFFAOYSA-N
SMILES:CC1=C(C=2C=C(C(OC)=O)C=NC2)N=CC=C1
Synonyms:- [2,3′-Bipyridine]-5′-carboxylic acid, 3-methyl-, methyl ester
- Methyl 3-methyl[2,3′-bipyridine]-5′-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
