CymitQuimica logo

CAS 1346686-62-1

:

3-Methyl[2,3′-bipyridine]-5′-methanol

Description:
3-Methyl[2,3′-bipyridine]-5′-methanol is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 3-position of one pyridine ring and a hydroxymethyl group at the 5′ position of the other ring contributes to its unique properties. This compound is likely to exhibit polar characteristics due to the hydroxymethyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the methyl group may influence its lipophilicity and overall reactivity. The bipyridine framework is known for its coordination chemistry, making this compound potentially useful in various applications, including catalysis and as a ligand in metal complexes. Its specific reactivity and interactions would depend on the surrounding conditions, such as pH and the presence of other chemical species. Overall, 3-Methyl[2,3′-bipyridine]-5′-methanol represents a versatile structure with potential applications in organic synthesis and materials science.
Formula:C12H12N2O
InChI:InChI=1S/C12H12N2O/c1-9-3-2-4-14-12(9)11-5-10(8-15)6-13-7-11/h2-7,15H,8H2,1H3
InChI key:InChIKey=HDJSDGCVNRJDSJ-UHFFFAOYSA-N
SMILES:CC1=C(C=2C=C(CO)C=NC2)N=CC=C1
Synonyms:
  • 3-Methyl[2,3′-bipyridine]-5′-methanol
  • [2,3′-Bipyridine]-5′-methanol, 3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.