CymitQuimica logo

CAS 1346686-64-3

:

3-Methyl[2,3′-bipyridine]-5′-methanamine

Description:
3-Methyl[2,3′-bipyridine]-5′-methanamine, identified by its CAS number 1346686-64-3, is an organic compound that features a bipyridine structure with a methyl group and a methanamine substituent. This compound is characterized by its aromatic nature due to the presence of the bipyridine moiety, which consists of two pyridine rings connected by a carbon-carbon bond. The methyl group at the 3-position and the methanamine group at the 5′-position contribute to its unique chemical properties, potentially influencing its reactivity and interaction with other molecules. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, making it relevant in various chemical reactions and applications. Additionally, the compound's structural features may allow it to act as a ligand in coordination chemistry or as an intermediate in organic synthesis. Its solubility, stability, and specific reactivity would depend on the surrounding conditions, such as solvent and temperature.
Formula:C12H13N3
InChI:InChI=1S/C12H13N3/c1-9-3-2-4-15-12(9)11-5-10(6-13)7-14-8-11/h2-5,7-8H,6,13H2,1H3
InChI key:InChIKey=RIARXHHPPQWECJ-UHFFFAOYSA-N
SMILES:CC1=C(C=2C=C(CN)C=NC2)N=CC=C1
Synonyms:
  • 3-Methyl[2,3′-bipyridine]-5′-methanamine
  • [2,3′-Bipyridine]-5′-methanamine, 3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.