CymitQuimica logo

CAS 1346686-66-5

:

Methyl 4-methyl[2,3′-bipyridine]-5′-carboxylate

Description:
Methyl 4-methyl[2,3′-bipyridine]-5′-carboxylate is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon bridge. This compound features a methyl group and a carboxylate functional group, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the methyl group enhances its lipophilicity, which can influence its solubility and interaction with biological systems. The carboxylate group can participate in hydrogen bonding and ionic interactions, making it a versatile building block in organic synthesis. Additionally, the compound's structural features may allow for coordination with metal ions, which is significant in coordination chemistry. Overall, Methyl 4-methyl[2,3′-bipyridine]-5′-carboxylate exhibits properties typical of heterocyclic compounds, including potential aromaticity and varied reactivity based on its functional groups. Its specific applications and behavior would depend on the context of its use in chemical reactions or formulations.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c1-9-3-4-15-12(5-9)10-6-11(8-14-7-10)13(16)17-2/h3-8H,1-2H3
InChI key:InChIKey=NXDDWVTXYHIXSW-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CN=C1)C2=CC(C)=CC=N2
Synonyms:
  • Methyl 4-methyl[2,3′-bipyridine]-5′-carboxylate
  • [2,3′-Bipyridine]-5′-carboxylic acid, 4-methyl-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.