
CAS 1346686-68-7
:4-Methyl[2,3′-bipyridine]-5′-carbonitrile
Description:
4-Methyl[2,3′-bipyridine]-5′-carbonitrile is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 4-position of one pyridine ring and a cyano group (-C≡N) at the 5′-position of the other ring contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the cyano group can participate in nucleophilic addition reactions, while the bipyridine framework can engage in coordination chemistry with metal ions. Overall, 4-Methyl[2,3′-bipyridine]-5′-carbonitrile is a versatile compound with unique properties stemming from its functional groups and aromatic system.
Formula:C12H9N3
InChI:InChI=1S/C12H9N3/c1-9-2-3-15-12(4-9)11-5-10(6-13)7-14-8-11/h2-5,7-8H,1H3
InChI key:InChIKey=VBDPFXLIMDIZRT-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C2=CC(C)=CC=N2
Synonyms:- 4-Methyl[2,3′-bipyridine]-5′-carbonitrile
- [2,3′-Bipyridine]-5′-carbonitrile, 4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
