
CAS 1346686-69-8
:4-Methyl[2,3′-bipyridine]-5′-methanol
Description:
4-Methyl[2,3′-bipyridine]-5′-methanol is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 4-position of one pyridine ring and a hydroxymethyl group at the 5′-position of the other ring contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the hydroxymethyl group, which can participate in hydrogen bonding, influencing its solubility in various solvents. Additionally, the methyl substituent may affect the compound's electronic properties, potentially enhancing its reactivity in certain chemical reactions. The bipyridine framework is known for its coordination chemistry, making this compound of interest in fields such as catalysis and materials science. Its specific applications may depend on its ability to form complexes with metal ions or its role as a ligand in various chemical processes. Overall, 4-Methyl[2,3′-bipyridine]-5′-methanol presents a versatile structure with potential utility in both synthetic and applied chemistry.
Formula:C12H12N2O
InChI:InChI=1S/C12H12N2O/c1-9-2-3-14-12(4-9)11-5-10(8-15)6-13-7-11/h2-7,15H,8H2,1H3
InChI key:InChIKey=ICSOJTFCUBWEBW-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)C2=CC(C)=CC=N2
Synonyms:- [2,3′-Bipyridine]-5′-methanol, 4-methyl-
- 4-Methyl[2,3′-bipyridine]-5′-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
