CAS 1346686-72-3

5-Methyl[2,3′-bipyridine]-5′-carboxylic acid

Description:

5-Methyl[2,3′-bipyridine]-5′-carboxylic acid is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 5-position of one pyridine ring and a carboxylic acid functional group at the 5′-position of the other ring contributes to its chemical reactivity and potential applications. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. Additionally, the bipyridine framework may impart coordination chemistry characteristics, making it useful in metal complexation and catalysis. The compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a ligand in coordination chemistry. Its specific reactivity and interactions would depend on the surrounding environment and the presence of other functional groups or metals. Overall, 5-Methyl[2,3′-bipyridine]-5′-carboxylic acid is a versatile compound with significant potential in various chemical applications.

Formula: C₁₂H₁₀N₂O₂

InChI: InChI=1S/C12H10N2O2/c1-8-2-3-11(14-5-8)9-4-10(12(15)16)7-13-6-9/h2-7H,1H3,(H,15,16)

InChI key: InChIKey=BEGSPJQLFFWHCD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CN=C1)C2=CC=C(C)C=N2

Synonyms:

• 5-Methyl[2,3′-bipyridine]-5′-carboxylic acid
• [2,3′-Bipyridine]-5′-carboxylic acid, 5-methyl-

5-Methyl-[2,3'-bipyridine]-5'-carboxylic acid

CAS: 1346686-72-3

Formula: C₁₂H₁₀N₂O₂

Molecular weight: 214.2200

Ref: IN-DA00HTG1