CymitQuimica logo

CAS 1346686-73-4

:

Methyl 5-methyl[2,3′-bipyridine]-5′-carboxylate

Description:
Methyl 5-methyl[2,3′-bipyridine]-5′-carboxylate is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon bridge. This compound features a methyl group and a carboxylate ester functional group, contributing to its reactivity and solubility properties. The presence of the methyl group at the 5-position of the bipyridine enhances its lipophilicity, making it more soluble in organic solvents. The carboxylate group can participate in various chemical reactions, including esterification and nucleophilic substitutions. This compound may exhibit interesting biological activities due to its structural features, making it a potential candidate for research in medicinal chemistry. Additionally, its unique structure allows for potential applications in materials science and coordination chemistry, where it can act as a ligand for metal ions. Overall, Methyl 5-methyl[2,3′-bipyridine]-5′-carboxylate is a versatile compound with significant implications in various fields of chemistry.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c1-9-3-4-12(15-6-9)10-5-11(8-14-7-10)13(16)17-2/h3-8H,1-2H3
InChI key:InChIKey=SKMXMGMFNTZFMP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CN=C1)C2=CC=C(C)C=N2
Synonyms:
  • [2,3′-Bipyridine]-5′-carboxylic acid, 5-methyl-, methyl ester
  • Methyl 5-methyl[2,3′-bipyridine]-5′-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.