CAS 1346686-78-9

5-Methyl[2,3′-bipyridine]-5′-methanamine

Description:

5-Methyl[2,3′-bipyridine]-5′-methanamine, identified by its CAS number 1346686-78-9, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon bridge. This compound features a methyl group at the 5-position of one pyridine ring and a methanamine group at the 5′-position of the other ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. The compound may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions, making it of interest in coordination chemistry and materials science. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as ligands in metal complexation. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₂H₁₃N₃

InChI: InChI=1S/C12H13N3/c1-9-2-3-12(15-6-9)11-4-10(5-13)7-14-8-11/h2-4,6-8H,5,13H2,1H3

InChI key: InChIKey=WGJILYUOEVJMAH-UHFFFAOYSA-N

SMILES: C(N)C1=CC(=CN=C1)C2=CC=C(C)C=N2

Synonyms:

• [2,3′-Bipyridine]-5′-methanamine, 5-methyl-
• 5-Methyl[2,3′-bipyridine]-5′-methanamine

(5-Methyl-[2,3'-bipyridin]-5'-yl)methanamine

CAS: 1346686-78-9

Formula: C₁₂H₁₃N₃

Molecular weight: 199.2517

Ref: IN-DA00HTG7