CymitQuimica logo

CAS 1346686-79-0

:

6-Methyl[2,3′-bipyridine]-5′-carboxylic acid

Description:
6-Methyl[2,3′-bipyridine]-5′-carboxylic acid is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 6-position and a carboxylic acid functional group at the 5′-position contributes to its chemical reactivity and solubility properties. This compound is likely to exhibit both acidic and basic characteristics due to the carboxylic acid group, which can donate protons, and the nitrogen atoms in the pyridine rings, which can act as bases. The bipyridine framework is known for its ability to chelate metal ions, making this compound potentially useful in coordination chemistry and catalysis. Additionally, the presence of the methyl group may influence the compound's steric properties and overall stability. Its applications could extend to fields such as organic synthesis, materials science, and medicinal chemistry, depending on its specific interactions and reactivity with other chemical species.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c1-8-3-2-4-11(14-8)9-5-10(12(15)16)7-13-6-9/h2-7H,1H3,(H,15,16)
InChI key:InChIKey=UPNPVLQWYAKAEE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1)C=2N=C(C)C=CC2
Synonyms:
  • 6-Methyl[2,3′-bipyridine]-5′-carboxylic acid
  • [2,3′-Bipyridine]-5′-carboxylic acid, 6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.