CymitQuimica logo

CAS 1346686-81-4

:

6-Methyl[2,3′-bipyridine]-5′-carboxamide

Description:
6-Methyl[2,3′-bipyridine]-5′-carboxamide is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 6-position and a carboxamide functional group at the 5′-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the carboxamide group, which can engage in hydrogen bonding, influencing its solubility in various solvents. The bipyridine framework may also participate in coordination chemistry, making it a potential ligand for metal ions. Additionally, the compound's structural features suggest potential applications in pharmaceuticals or materials science, particularly in the development of organic semiconductors or as a building block in the synthesis of more complex molecules. Its stability and reactivity would depend on the specific conditions, such as pH and temperature, under which it is handled. Overall, 6-Methyl[2,3′-bipyridine]-5′-carboxamide represents a versatile compound with interesting chemical behavior.
Formula:C12H11N3O
InChI:InChI=1S/C12H11N3O/c1-8-3-2-4-11(15-8)9-5-10(12(13)16)7-14-6-9/h2-7H,1H3,(H2,13,16)
InChI key:InChIKey=PXWMPJCVTGCCNT-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C=2N=C(C)C=CC2
Synonyms:
  • [2,3′-Bipyridine]-5′-carboxamide, 6-methyl-
  • 6-Methyl[2,3′-bipyridine]-5′-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.