
CAS 1346686-83-6
:6-Methyl[2,3′-bipyridine]-5′-carbonitrile
Description:
6-Methyl[2,3′-bipyridine]-5′-carbonitrile is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 6-position and a cyano group at the 5′-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the polar nature of the cyano group. It may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions, making it of interest in coordination chemistry and materials science. The compound's structure suggests potential applications in organic synthesis, pharmaceuticals, and as a ligand in metal complexes. Additionally, its properties can be influenced by factors such as temperature and solvent choice, which can affect its reactivity and stability. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C12H9N3
InChI:InChI=1S/C12H9N3/c1-9-3-2-4-12(15-9)11-5-10(6-13)7-14-8-11/h2-5,7-8H,1H3
InChI key:InChIKey=PAECHUOSAXBVBD-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C=2N=C(C)C=CC2
Synonyms:- 6-Methyl[2,3′-bipyridine]-5′-carbonitrile
- [2,3′-Bipyridine]-5′-carbonitrile, 6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
