CymitQuimica logo

CAS 1346686-84-7

:

6-Methyl[2,3′-bipyridine]-5′-methanol

Description:
6-Methyl[2,3′-bipyridine]-5′-methanol is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 6-position and a hydroxymethyl group at the 5′-position contributes to its unique chemical properties. This compound is likely to exhibit polar characteristics due to the hydroxymethyl group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the bipyridine framework can engage in coordination chemistry, making it a potential ligand for metal ions. The compound may also display interesting electronic properties due to the conjugated system of the pyridine rings, which can influence its reactivity and interaction with other chemical species. Its applications could span various fields, including organic synthesis, materials science, and medicinal chemistry, particularly in the development of pharmaceuticals or catalysts. As with any chemical substance, safety and handling precautions should be observed, given the potential toxicity associated with nitrogen-containing heterocycles.
Formula:C12H12N2O
InChI:InChI=1S/C12H12N2O/c1-9-3-2-4-12(14-9)11-5-10(8-15)6-13-7-11/h2-7,15H,8H2,1H3
InChI key:InChIKey=RDRQTXSKFDMMQG-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)C=2N=C(C)C=CC2
Synonyms:
  • [2,3′-Bipyridine]-5′-methanol, 6-methyl-
  • 6-Methyl[2,3′-bipyridine]-5′-methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.