
CAS 1346686-85-8
:6-Methyl[2,3′-bipyridine]-5′-carboxaldehyde
Description:
6-Methyl[2,3′-bipyridine]-5′-carboxaldehyde is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 6-position and a carboxaldehyde functional group at the 5′-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit properties typical of aldehydes, such as being a good electrophile due to the carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. Additionally, the bipyridine framework may enhance its coordination chemistry, allowing it to form complexes with transition metals. The compound's solubility, stability, and reactivity can be influenced by the presence of the methyl group and the overall electronic environment of the bipyridine system. Its unique structure makes it a candidate for further research in fields such as catalysis, materials science, and drug development.
Formula:C12H10N2O
InChI:InChI=1S/C12H10N2O/c1-9-3-2-4-12(14-9)11-5-10(8-15)6-13-7-11/h2-8H,1H3
InChI key:InChIKey=ROFTTWYOVYNBCT-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C=2N=C(C)C=CC2
Synonyms:- [2,3′-Bipyridine]-5′-carboxaldehyde, 6-methyl-
- 6-Methyl[2,3′-bipyridine]-5′-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
