
CAS 1346686-88-1
:Methyl 5-fluoro[2,3′-bipyridine]-5′-carboxylate
Description:
Methyl 5-fluoro[2,3′-bipyridine]-5′-carboxylate is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a fluorine atom at the 5-position of the bipyridine moiety introduces unique electronic properties, potentially enhancing its reactivity and influencing its interactions in various chemical environments. The carboxylate functional group, esterified with a methyl group, contributes to its solubility and reactivity, making it a useful intermediate in organic synthesis. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential applications in agrochemicals, pharmaceuticals, and materials science. As with many fluorinated compounds, it may possess distinct physical properties, such as altered boiling and melting points, compared to its non-fluorinated counterparts. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated organic compounds.
Formula:C12H9FN2O2
InChI:InChI=1S/C12H9FN2O2/c1-17-12(16)9-4-8(5-14-6-9)11-3-2-10(13)7-15-11/h2-7H,1H3
InChI key:InChIKey=XYEHARMGGBUCRI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CN=C1)C2=CC=C(F)C=N2
Synonyms:- [2,3′-Bipyridine]-5′-carboxylic acid, 5-fluoro-, methyl ester
- Methyl 5-fluoro[2,3′-bipyridine]-5′-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
