
CAS 1346686-90-5
:5-Fluoro[2,3′-bipyridine]-5′-carbonitrile
Description:
5-Fluoro[2,3′-bipyridine]-5′-carbonitrile is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a fluorine atom at the 5-position of the bipyridine moiety and a cyano group (-C≡N) at the 5′-position contributes to its unique chemical properties. This compound is typically used in medicinal chemistry and material science due to its potential as a building block in the synthesis of various pharmaceuticals and agrochemicals. Its polar functional groups enhance solubility in polar solvents, while the fluorine atom can influence the compound's electronic properties and reactivity. Additionally, the cyano group can participate in nucleophilic reactions, making it a versatile intermediate in organic synthesis. The compound's stability and reactivity profile make it of interest in research and development, particularly in the fields of drug discovery and coordination chemistry.
Formula:C11H6FN3
InChI:InChI=1S/C11H6FN3/c12-10-1-2-11(15-7-10)9-3-8(4-13)5-14-6-9/h1-3,5-7H
InChI key:InChIKey=GLDJVVCCOIUSSV-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C2=CC=C(F)C=N2
Synonyms:- [2,3′-Bipyridine]-5′-carbonitrile, 5-fluoro-
- 5-Fluoro[2,3′-bipyridine]-5′-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
