CymitQuimica logo

CAS 1346686-96-1

:

6-Fluoro[2,3′-bipyridine]-5′-carboxamide

Description:
6-Fluoro[2,3′-bipyridine]-5′-carboxamide is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a fluorine atom at the 6-position of the bipyridine moiety introduces unique electronic and steric properties, potentially influencing its reactivity and interactions with biological targets. The carboxamide functional group at the 5′ position enhances its solubility in polar solvents and may contribute to hydrogen bonding capabilities, making it a candidate for various applications in medicinal chemistry and material science. This compound may exhibit interesting pharmacological properties, as modifications in the bipyridine framework can lead to variations in biological activity. Additionally, its structural features suggest potential utility in coordination chemistry, where it could act as a ligand for metal ions. Overall, 6-Fluoro[2,3′-bipyridine]-5′-carboxamide represents a versatile scaffold for further exploration in chemical research and development.
Formula:C11H8FN3O
InChI:InChI=1S/C11H8FN3O/c12-10-3-1-2-9(15-10)7-4-8(11(13)16)6-14-5-7/h1-6H,(H2,13,16)
InChI key:InChIKey=QXEPDNNFBYWIGC-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C=2N=C(F)C=CC2
Synonyms:
  • 6-Fluoro[2,3′-bipyridine]-5′-carboxamide
  • [2,3′-Bipyridine]-5′-carboxamide, 6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.