CymitQuimica logo

CAS 1346686-98-3

:

6-Fluoro[2,3′-bipyridine]-5′-methanol

Description:
6-Fluoro[2,3′-bipyridine]-5′-methanol is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a fluorine atom at the 6-position of the bipyridine moiety introduces unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. The methanol group at the 5′ position contributes to its polar characteristics, making it suitable for interactions with other polar molecules. This compound may exhibit interesting biological activities due to its structural features, which can influence its binding affinity to biological targets. Additionally, the fluorine substitution can affect the compound's lipophilicity and metabolic stability. As with many bipyridine derivatives, it may find applications in coordination chemistry, catalysis, or as a ligand in metal complexes. Overall, 6-Fluoro[2,3′-bipyridine]-5′-methanol is a versatile compound with potential implications in both synthetic and medicinal chemistry.
Formula:C11H9FN2O
InChI:InChI=1S/C11H9FN2O/c12-11-3-1-2-10(14-11)9-4-8(7-15)5-13-6-9/h1-6,15H,7H2
InChI key:InChIKey=CLGUHKPNXWABIH-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)C=2N=C(F)C=CC2
Synonyms:
  • 6-Fluoro[2,3′-bipyridine]-5′-methanol
  • [2,3′-Bipyridine]-5′-methanol, 6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.