
CAS 1346686-99-4
:6-Fluoro[2,3′-bipyridine]-5′-carboxaldehyde
Description:
6-Fluoro[2,3′-bipyridine]-5′-carboxaldehyde is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a fluorine atom at the 6-position of the bipyridine moiety and an aldehyde functional group at the 5′ position contributes to its unique reactivity and properties. This compound is typically used in organic synthesis and medicinal chemistry, often serving as an intermediate in the development of pharmaceuticals or agrochemicals. Its aldehyde group makes it a versatile building block for further chemical modifications, allowing for the introduction of various functional groups. Additionally, the fluorine substitution can enhance the compound's lipophilicity and biological activity. The compound's molecular structure and functional groups suggest potential applications in coordination chemistry and as a ligand in metal complexes. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and reactivity.
Formula:C11H7FN2O
InChI:InChI=1S/C11H7FN2O/c12-11-3-1-2-10(14-11)9-4-8(7-15)5-13-6-9/h1-7H
InChI key:InChIKey=WRPBZJGNDKSQCW-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C=2N=C(F)C=CC2
Synonyms:- [2,3′-Bipyridine]-5′-carboxaldehyde, 6-fluoro-
- 6-Fluoro[2,3′-bipyridine]-5′-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
