CymitQuimica logo

CAS 1346687-01-1

:

6-Bromo[2,3′-bipyridine]-5′-carboxylic acid

Description:
6-Bromo[2,3′-bipyridine]-5′-carboxylic acid is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a bromine atom at the 6-position and a carboxylic acid functional group at the 5′-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit properties typical of halogenated aromatic compounds, such as increased lipophilicity and potential for electrophilic substitution reactions. The carboxylic acid group can participate in hydrogen bonding and may influence solubility in polar solvents. Additionally, the bipyridine framework is known for its ability to chelate metal ions, making this compound of interest in coordination chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals, agrochemicals, or as a ligand in catalysis. As with many organic compounds, safety and handling precautions should be observed due to the presence of bromine and the potential for reactivity.
Formula:C11H7BrN2O2
InChI:InChI=1S/C11H7BrN2O2/c12-10-3-1-2-9(14-10)7-4-8(11(15)16)6-13-5-7/h1-6H,(H,15,16)
InChI key:InChIKey=MNYHYSYGBOPSIJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1)C=2N=C(Br)C=CC2
Synonyms:
  • [2,3′-Bipyridine]-5′-carboxylic acid, 6-bromo-
  • 6-Bromo[2,3′-bipyridine]-5′-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.