CAS 1346687-03-3

Methyl 6-bromo[2,3′-bipyridine]-5′-carboxylate

Description:

Methyl 6-bromo[2,3′-bipyridine]-5′-carboxylate is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a bromine atom at the 6-position of the bipyridine moiety introduces notable reactivity and influences the compound's electronic properties. The carboxylate functional group, specifically the methyl ester, contributes to its solubility in organic solvents and can participate in various chemical reactions, such as esterification and nucleophilic substitution. This compound is likely to exhibit moderate to high stability under standard conditions, although it may be sensitive to strong bases or nucleophiles due to the electrophilic nature of the carbonyl carbon in the ester group. Its unique structure makes it a potential candidate for applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, where the bipyridine framework is often associated with biological activity. Overall, Methyl 6-bromo[2,3′-bipyridine]-5′-carboxylate is a versatile compound with interesting chemical properties.

Formula: C₁₂H₉BrN₂O₂

InChI: InChI=1S/C12H9BrN2O2/c1-17-12(16)9-5-8(6-14-7-9)10-3-2-4-11(13)15-10/h2-7H,1H3

InChI key: InChIKey=DUPGRKQQUYHHKF-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(=CN=C1)C=2N=C(Br)C=CC2

Synonyms:

• [2,3′-Bipyridine]-5′-carboxylic acid, 6-bromo-, methyl ester
• Methyl 6-bromo[2,3′-bipyridine]-5′-carboxylate

Methyl 6-bromo-[2,3'-bipyridine]-5'-carboxylate

CAS: 1346687-03-3

Formula: C₁₂H₉BrN₂O₂

Molecular weight: 293.1161

Ref: IN-DA00HTGU