CymitQuimica logo

CAS 1346687-05-5

:

6-Bromo[2,3′-bipyridine]-5′-carboxamide

Description:
6-Bromo[2,3′-bipyridine]-5′-carboxamide is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a bromine atom at the 6-position and a carboxamide functional group at the 5′-position contributes to its unique chemical properties. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxamide group, which can engage in hydrogen bonding. The bromine substituent may influence its reactivity, potentially allowing for further functionalization or participation in nucleophilic substitution reactions. Additionally, the bipyridine framework is known for its ability to chelate metal ions, making this compound of interest in coordination chemistry and catalysis. Its potential applications may extend to medicinal chemistry, where derivatives of bipyridine compounds are often explored for biological activity. Overall, 6-Bromo[2,3′-bipyridine]-5′-carboxamide presents a versatile scaffold for further chemical exploration and development.
Formula:C11H8BrN3O
InChI:InChI=1S/C11H8BrN3O/c12-10-3-1-2-9(15-10)7-4-8(11(13)16)6-14-5-7/h1-6H,(H2,13,16)
InChI key:InChIKey=GUZMCLQZODNDSX-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C=2N=C(Br)C=CC2
Synonyms:
  • [2,3′-Bipyridine]-5′-carboxamide, 6-bromo-
  • 6-Bromo[2,3′-bipyridine]-5′-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.