CymitQuimica logo

CAS 1346687-06-6

:

6-Bromo[2,3′-bipyridine]-5′-carbonitrile

Description:
6-Bromo[2,3′-bipyridine]-5′-carbonitrile is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a bromine atom at the 6-position and a cyano group (-C≡N) at the 5′-position contributes to its unique reactivity and potential applications in various fields, including medicinal chemistry and materials science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent properties. Its functional groups suggest potential for nucleophilic substitution reactions and coordination with metal ions, making it of interest for the development of coordination complexes. Additionally, the bromine substituent can serve as a site for further functionalization, enhancing its utility in synthetic pathways. Overall, 6-Bromo[2,3′-bipyridine]-5′-carbonitrile is a versatile compound with significant implications in chemical research and development.
Formula:C11H6BrN3
InChI:InChI=1S/C11H6BrN3/c12-11-3-1-2-10(15-11)9-4-8(5-13)6-14-7-9/h1-4,6-7H
InChI key:InChIKey=BXOGSEIANQIAGP-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C=2N=C(Br)C=CC2
Synonyms:
  • 6-Bromo[2,3′-bipyridine]-5′-carbonitrile
  • [2,3′-Bipyridine]-5′-carbonitrile, 6-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.