
CAS 1346687-07-7
:6-Bromo[2,3′-bipyridine]-5′-methanol
Description:
6-Bromo[2,3′-bipyridine]-5′-methanol is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a bromine atom at the 6-position of the bipyridine moiety introduces significant electrophilic properties, making it a useful intermediate in various chemical reactions, including cross-coupling reactions. The methanol group at the 5′ position serves as a functional group that can participate in further chemical transformations, such as oxidation or substitution reactions. This compound is typically used in organic synthesis and medicinal chemistry, where modifications to the bipyridine framework can lead to the development of biologically active molecules. Its solubility and reactivity can vary depending on the solvent and reaction conditions, making it versatile for various applications. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C11H9BrN2O
InChI:InChI=1S/C11H9BrN2O/c12-11-3-1-2-10(14-11)9-4-8(7-15)5-13-6-9/h1-6,15H,7H2
InChI key:InChIKey=NGSHSZHSVHLWPQ-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)C=2N=C(Br)C=CC2
Synonyms:- 6-Bromo[2,3′-bipyridine]-5′-methanol
- [2,3′-Bipyridine]-5′-methanol, 6-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
