
CAS 1346687-08-8
:6-Bromo[2,3′-bipyridine]-5′-carboxaldehyde
Description:
6-Bromo[2,3′-bipyridine]-5′-carboxaldehyde is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a bromine atom at the 6-position and an aldehyde functional group at the 5′-position significantly influences its chemical reactivity and properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). It is often used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, including nucleophilic additions and coupling reactions. The bromine substituent can serve as a site for further functionalization, making it a versatile intermediate in chemical synthesis. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry contexts. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H7BrN2O
InChI:InChI=1S/C11H7BrN2O/c12-11-3-1-2-10(14-11)9-4-8(7-15)5-13-6-9/h1-7H
InChI key:InChIKey=JKZGGKFOMLROIL-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C=2N=C(Br)C=CC2
Synonyms:- [2,3′-Bipyridine]-5′-carboxaldehyde, 6-bromo-
- 6-Bromo[2,3′-bipyridine]-5′-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
