
CAS 1346687-09-9
:6-Bromo[2,3′-bipyridine]-5′-methanamine
Description:
6-Bromo[2,3′-bipyridine]-5′-methanamine is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon bridge. The presence of a bromine atom at the 6-position of the bipyridine moiety introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The methanamine group at the 5′ position contributes to its basicity and potential for forming hydrogen bonds, which can enhance its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features allow for interactions with biological targets, potentially influencing its pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by the surrounding functional groups and the electronic effects of the bromine substituent. Overall, 6-Bromo[2,3′-bipyridine]-5′-methanamine is a versatile compound with applications in research and development within organic and medicinal chemistry.
Formula:C11H10BrN3
InChI:InChI=1S/C11H10BrN3/c12-11-3-1-2-10(15-11)9-4-8(5-13)6-14-7-9/h1-4,6-7H,5,13H2
InChI key:InChIKey=JWFBDFACDRALLV-UHFFFAOYSA-N
SMILES:C(N)C1=CC(=CN=C1)C=2N=C(Br)C=CC2
Synonyms:- 6-Bromo[2,3′-bipyridine]-5′-methanamine
- [2,3′-Bipyridine]-5′-methanamine, 6-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
