CymitQuimica logo

CAS 1346687-14-6

:

5-(3-Thienyl)-3-pyridinecarbonitrile

Description:
5-(3-Thienyl)-3-pyridinecarbonitrile is an organic compound characterized by its unique structural features, which include a pyridine ring and a thienyl group. The presence of the cyano group (-C≡N) attached to the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for heterocyclic compounds. Its molecular structure suggests potential for interactions in biological systems, making it of interest in medicinal chemistry and drug development. The thienyl moiety can enhance the compound's electronic properties, potentially influencing its behavior in electronic applications or as a ligand in coordination chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 5-(3-Thienyl)-3-pyridinecarbonitrile represents a versatile building block in organic synthesis and materials science.
Formula:C10H6N2S
InChI:InChI=1S/C10H6N2S/c11-4-8-3-10(6-12-5-8)9-1-2-13-7-9/h1-3,5-7H
InChI key:InChIKey=IQCARORNUUZCOV-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C=2C=CSC2
Synonyms:
  • 5-(3-Thienyl)-3-pyridinecarbonitrile
  • 3-Pyridinecarbonitrile, 5-(3-thienyl)-
  • 5-(Thiophen-3-yl)nicotinonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.